C10H14ClN3O3S2 — CID 77039217
1-(5-chlorothiophen-2-yl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide (PubChem CID 77039217) has the molecular formula C10H14ClN3O3S2 and a molecular weight of 323.83 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77039217 |
| Molecular Formula | C10H14ClN3O3S2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide |
| SMILES | NC(=NO)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C10H14ClN3O3S2/c11-8-1-2-9(18-8)19(16,17)14-5-3-7(4-6-14)10(12)13-15/h1-2,7,15H,3-6H2,(H2,12,13) |
| InChIKey | YAIKPPSRHUUBPC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|