C9H12ClNO4S3 — CID 90584698
1-(5-chlorothiophen-2-yl)sulfonyl-3-methylsulfonylpyrrolidine (PubChem CID 90584698) has the molecular formula C9H12ClNO4S3 and a molecular weight of 329.85 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-methylsulfonylpyrrolidine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 90584698 |
| Molecular Formula | C9H12ClNO4S3 |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-methylsulfonylpyrrolidine |
| SMILES | CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C9H12ClNO4S3/c1-17(12,13)7-4-5-11(6-7)18(14,15)9-3-2-8(10)16-9/h2-3,7H,4-6H2,1H3 |
| InChIKey | IQEJJWUEKLLQKN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |