C10H13ClN2O3S2 — CID 18078359
1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide (PubChem CID 18078359) has the molecular formula C10H13ClN2O3S2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 18078359 |
| Molecular Formula | C10H13ClN2O3S2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C10H13ClN2O3S2/c11-8-1-2-9(17-8)18(15,16)13-5-3-7(4-6-13)10(12)14/h1-2,7H,3-6H2,(H2,12,14) |
| InChIKey | ZQNFCPQBVRPSPL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |