C16H16BrClN2O3S2 — CID 16803661
N-(4-bromophenyl)-1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide (PubChem CID 16803661) has the molecular formula C16H16BrClN2O3S2 and a molecular weight of 463.81 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16803661 |
| Molecular Formula | C16H16BrClN2O3S2 |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | N-(4-bromophenyl)-1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H16BrClN2O3S2/c17-12-1-3-13(4-2-12)19-16(21)11-7-9-20(10-8-11)25(22,23)15-6-5-14(18)24-15/h1-6,11H,7-10H2,(H,19,21) |
| InChIKey | MUCHTJOLHZQKEJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |