C16H16BrN3O5S2 — CID 43025510
1-(5-bromothiophen-2-yl)sulfonyl-N-(4-nitrophenyl)piperidine-4-carboxamide (PubChem CID 43025510) has the molecular formula C16H16BrN3O5S2 and a molecular weight of 474.36 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43025510 |
| Molecular Formula | C16H16BrN3O5S2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-nitrophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C16H16BrN3O5S2/c17-14-5-6-15(26-14)27(24,25)19-9-7-11(8-10-19)16(21)18-12-1-3-13(4-2-12)20(22)23/h1-6,11H,7-10H2,(H,18,21) |
| InChIKey | DIHJQNZUZGOCBA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|