C17H18BrClN2O3S2 — CID 26264234
1-(5-bromothiophen-2-yl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-4-carboxamide (PubChem CID 26264234) has the molecular formula C17H18BrClN2O3S2 and a molecular weight of 477.83 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26264234 |
| Molecular Formula | C17H18BrClN2O3S2 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H18BrClN2O3S2/c1-11-2-3-14(13(19)10-11)20-17(22)12-6-8-21(9-7-12)26(23,24)16-5-4-15(18)25-16/h2-5,10,12H,6-9H2,1H3,(H,20,22) |
| InChIKey | VVBHTJRMKASYNJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |