C19H23BrN2O3S2 — CID 15989573
1-(5-bromothiophen-2-yl)sulfonyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide (PubChem CID 15989573) has the molecular formula C19H23BrN2O3S2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 15989573 |
| Molecular Formula | C19H23BrN2O3S2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C19H23BrN2O3S2/c1-13(2)14-3-5-16(6-4-14)21-19(23)15-9-11-22(12-10-15)27(24,25)18-8-7-17(20)26-18/h3-8,13,15H,9-12H2,1-2H3,(H,21,23) |
| InChIKey | XIGQWRGYDVDCRS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |