C12H16ClNO4S2 — CID 62215968
3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoic acid (PubChem CID 62215968) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 62215968 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H16ClNO4S2/c13-10-2-4-12(19-10)20(17,18)14-7-5-9(6-8-14)1-3-11(15)16/h2,4,9H,1,3,5-8H2,(H,15,16) |
| InChIKey | XYVOTRQJABMOKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |