C15H21ClN2O3S2 — CID 7972513
1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-cyclopentylethanone (PubChem CID 7972513) has the molecular formula C15H21ClN2O3S2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-cyclopentylethanone.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 7972513 |
| Molecular Formula | C15H21ClN2O3S2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H21ClN2O3S2/c16-13-5-6-15(22-13)23(20,21)18-9-7-17(8-10-18)14(19)11-12-3-1-2-4-12/h5-6,12H,1-4,7-11H2 |
| InChIKey | JNDMIXYLZVLHDI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |