C16H17ClN2O3S3 — CID 26679152
1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-phenylsulfanylethanone (PubChem CID 26679152) has the molecular formula C16H17ClN2O3S3 and a molecular weight of 416.98 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 26679152 |
| Molecular Formula | C16H17ClN2O3S3 |
| Molecular Weight | 416.98 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-phenylsulfanylethanone |
| SMILES | O=C(CSc1ccccc1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H17ClN2O3S3/c17-14-6-7-16(24-14)25(21,22)19-10-8-18(9-11-19)15(20)12-23-13-4-2-1-3-5-13/h1-7H,8-12H2 |
| InChIKey | NANMERXPIZPGNE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |