C14H21ClN2O3S2 — CID 78773434
1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]hexan-1-one (PubChem CID 78773434) has the molecular formula C14H21ClN2O3S2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 78773434 |
| Molecular Formula | C14H21ClN2O3S2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H21ClN2O3S2/c1-2-3-4-5-13(18)16-8-10-17(11-9-16)22(19,20)14-7-6-12(15)21-14/h6-7H,2-5,8-11H2,1H3 |
| InChIKey | OXHQSUBLIUGZMI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|