C14H16ClN3O3S2 — CID 110805258
[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylpyrrol-3-yl)methanone (PubChem CID 110805258) has the molecular formula C14H16ClN3O3S2 and a molecular weight of 373.89 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylpyrrol-3-yl)methanone.
| Compound Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 110805258 |
| Molecular Formula | C14H16ClN3O3S2 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylpyrrol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1 |
| InChI | InChI=1S/C14H16ClN3O3S2/c1-16-5-4-11(10-16)14(19)17-6-8-18(9-7-17)23(20,21)13-3-2-12(15)22-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | RJYBNJFIKTYJSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |