C22H20ClN3O4S2 — CID 46564070
N-[4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]phenyl]benzamide (PubChem CID 46564070) has the molecular formula C22H20ClN3O4S2 and a molecular weight of 490.01 g/mol. Its IUPAC name is N-[4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]phenyl]benzamide.
| Compound Name | N-[4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46564070 |
| Molecular Formula | C22H20ClN3O4S2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | N-[4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carbonyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20ClN3O4S2/c23-19-10-11-20(31-19)32(29,30)26-14-12-25(13-15-26)22(28)17-6-8-18(9-7-17)24-21(27)16-4-2-1-3-5-16/h1-11H,12-15H2,(H,24,27) |
| InChIKey | NLAHVLVNLBFVGO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |