C28H26ClN3O3S2 — CID 2353026
N-[4-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 2353026) has the molecular formula C28H26ClN3O3S2 and a molecular weight of 552.12 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[4-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2353026 |
| Molecular Formula | C28H26ClN3O3S2 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H26ClN3O3S2/c29-25-15-16-26(36-25)37(34,35)30-24-13-11-23(12-14-24)28(33)32-19-17-31(18-20-32)27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-16,27,30H,17-20H2 |
| InChIKey | ZQLVLPJMGWZMOW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |