C24H22BrClN2O — CID 92769694
[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(4-chlorophenyl)methanone (PubChem CID 92769694) has the molecular formula C24H22BrClN2O and a molecular weight of 469.81 g/mol. Its IUPAC name is [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 92769694 |
| Molecular Formula | C24H22BrClN2O |
| Molecular Weight | 469.81 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(4-chlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN([C@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C24H22BrClN2O/c25-21-10-6-19(7-11-21)23(18-4-2-1-3-5-18)27-14-16-28(17-15-27)24(29)20-8-12-22(26)13-9-20/h1-13,23H,14-17H2/t23-/m1/s1 |
| InChIKey | BOQWCHJOYWRSJH-HSZRJFAPSA-N |
| XLogP | 5.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.81 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |