C25H25BrN2O — CID 92769177
[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(2-methylphenyl)methanone (PubChem CID 92769177) has the molecular formula C25H25BrN2O and a molecular weight of 449.39 g/mol. Its IUPAC name is [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 92769177 |
| Molecular Formula | C25H25BrN2O |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCN([C@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C25H25BrN2O/c1-19-7-5-6-10-23(19)25(29)28-17-15-27(16-18-28)24(20-8-3-2-4-9-20)21-11-13-22(26)14-12-21/h2-14,24H,15-18H2,1H3/t24-/m1/s1 |
| InChIKey | HHKLZXQCPYSRPL-XMMPIXPASA-N |
| XLogP | 5.30 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |