C23H29BrN2O — CID 92760743
1-[4-[(S)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-ethylbutan-1-one (PubChem CID 92760743) has the molecular formula C23H29BrN2O and a molecular weight of 429.40 g/mol. Its IUPAC name is 1-[4-[(S)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[4-[(S)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 92760743 |
| Molecular Formula | C23H29BrN2O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[4-[(S)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCN([C@@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H29BrN2O/c1-3-18(4-2)23(27)26-16-14-25(15-17-26)22(19-8-6-5-7-9-19)20-10-12-21(24)13-11-20/h5-13,18,22H,3-4,14-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | DTBXJAUBSZACAI-QFIPXVFZSA-N |
| XLogP | 5.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |