C27H28Cl2N2O — CID 92770642
(2R)-1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-phenylbutan-1-one (PubChem CID 92770642) has the molecular formula C27H28Cl2N2O and a molecular weight of 467.44 g/mol. Its IUPAC name is (2R)-1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-phenylbutan-1-one.
| Compound Name | (2R)-1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 92770642 |
| Molecular Formula | C27H28Cl2N2O |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (2R)-1-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-2-phenylbutan-1-one |
| SMILES | CC[C@@H](C(=O)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H28Cl2N2O/c1-2-25(20-6-4-3-5-7-20)27(32)31-18-16-30(17-19-31)26(21-8-12-23(28)13-9-21)22-10-14-24(29)15-11-22/h3-15,25-26H,2,16-19H2,1H3/t25-/m1/s1 |
| InChIKey | YUKXASBYVBSLND-RUZDIDTESA-N |
| XLogP | 6.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |