C31H30ClN3O — CID 11634655
1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-(N-phenylanilino)ethanone (PubChem CID 11634655) has the molecular formula C31H30ClN3O and a molecular weight of 496.05 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-(N-phenylanilino)ethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-(N-phenylanilino)ethanone |
|---|---|
| PubChem CID | 11634655 |
| Molecular Formula | C31H30ClN3O |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-(N-phenylanilino)ethanone |
| SMILES | O=C(CN(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C31H30ClN3O/c32-27-18-16-26(17-19-27)31(25-10-4-1-5-11-25)34-22-20-33(21-23-34)30(36)24-35(28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-19,31H,20-24H2 |
| InChIKey | RLEMIIBGFDBVBD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |