C32H32ClN3O3S — CID 1002153
N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-N-benzyl-4-chlorobenzenesulfonamide (PubChem CID 1002153) has the molecular formula C32H32ClN3O3S and a molecular weight of 574.15 g/mol. Its IUPAC name is N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-N-benzyl-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-N-benzyl-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 1002153 |
| Molecular Formula | C32H32ClN3O3S |
| Molecular Weight | 574.15 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-N-benzyl-4-chlorobenzenesulfonamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H32ClN3O3S/c33-29-16-18-30(19-17-29)40(38,39)36(24-26-10-4-1-5-11-26)25-31(37)34-20-22-35(23-21-34)32(27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-19,32H,20-25H2 |
| InChIKey | MVKYHZRKTJHZBJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.15 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |