C25H25BrClN3O3S — CID 126070627
N-benzyl-4-bromo-N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 126070627) has the molecular formula C25H25BrClN3O3S and a molecular weight of 562.92 g/mol. Its IUPAC name is N-benzyl-4-bromo-N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-bromo-N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126070627 |
| Molecular Formula | C25H25BrClN3O3S |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | N-benzyl-4-bromo-N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H25BrClN3O3S/c26-21-9-11-24(12-10-21)34(32,33)30(18-20-5-2-1-3-6-20)19-25(31)29-15-13-28(14-16-29)23-8-4-7-22(27)17-23/h1-12,17H,13-16,18-19H2 |
| InChIKey | OPFSVYLAIMPWQT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |