C20H23BrN2O3S — CID 1120651
N-benzyl-4-bromo-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 1120651) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-benzyl-4-bromo-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | N-benzyl-4-bromo-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1120651 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-benzyl-4-bromo-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)N1CCCCC1 |
| InChI | InChI=1S/C20H23BrN2O3S/c21-18-9-11-19(12-10-18)27(25,26)23(15-17-7-3-1-4-8-17)16-20(24)22-13-5-2-6-14-22/h1,3-4,7-12H,2,5-6,13-16H2 |
| InChIKey | HVTGOXFAPSSFJH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |