C26H28BrN3O3S — CID 3355285
N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-N-[(4-bromophenyl)methyl]benzenesulfonamide (PubChem CID 3355285) has the molecular formula C26H28BrN3O3S and a molecular weight of 542.50 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-N-[(4-bromophenyl)methyl]benzenesulfonamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-N-[(4-bromophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3355285 |
| Molecular Formula | C26H28BrN3O3S |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-N-[(4-bromophenyl)methyl]benzenesulfonamide |
| SMILES | O=C(CN(Cc1ccc(Br)cc1)S(=O)(=O)c1ccccc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H28BrN3O3S/c27-24-13-11-23(12-14-24)20-30(34(32,33)25-9-5-2-6-10-25)21-26(31)29-17-15-28(16-18-29)19-22-7-3-1-4-8-22/h1-14H,15-21H2 |
| InChIKey | GJMOEGQPMVDTAN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |