C27H30ClN3O3S — CID 3354978
N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-chloro-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 3354978) has the molecular formula C27H30ClN3O3S and a molecular weight of 512.08 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-chloro-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-chloro-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3354978 |
| Molecular Formula | C27H30ClN3O3S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-chloro-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | O=C(CN(CCc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O3S/c28-25-11-13-26(14-12-25)35(33,34)31(16-15-23-7-3-1-4-8-23)22-27(32)30-19-17-29(18-20-30)21-24-9-5-2-6-10-24/h1-14H,15-22H2 |
| InChIKey | LTFAYCZQZHVMFN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |