C15H13BrNO4S- — CID 7317037
2-[benzyl-(4-bromophenyl)sulfonylamino]acetate (PubChem CID 7317037) has the molecular formula C15H13BrNO4S- and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]acetate.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7317037 |
| Molecular Formula | C15H13BrNO4S- |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]acetate |
| SMILES | O=C([O-])CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrNO4S/c16-13-6-8-14(9-7-13)22(20,21)17(11-15(18)19)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19)/p-1 |
| InChIKey | KECSIUYPOBCMOK-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |