C17H18NO4S- — CID 7317776
2-[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 7317776) has the molecular formula C17H18NO4S- and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | 2-[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7317776 |
| Molecular Formula | C17H18NO4S- |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[(4-methylphenyl)methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(CN(CC(=O)[O-])S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-13-3-7-15(8-4-13)11-18(12-17(19)20)23(21,22)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | OROVTOGCSHOTNV-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |