C16H18FN3O3S — CID 126072480
N-[(4-fluorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)-4-methylbenzenesulfonamide (PubChem CID 126072480) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 126072480 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(2-hydrazinyl-2-oxoethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NN)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H18FN3O3S/c1-12-2-8-15(9-3-12)24(22,23)20(11-16(21)19-18)10-13-4-6-14(17)7-5-13/h2-9H,10-11,18H2,1H3,(H,19,21) |
| InChIKey | HASJUIVGQUZASU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|