C26H23FN2O3S — CID 126062395
2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-naphthalen-1-ylacetamide (PubChem CID 126062395) has the molecular formula C26H23FN2O3S and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126062395 |
| Molecular Formula | C26H23FN2O3S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-naphthalen-1-ylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2cccc3ccccc23)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H23FN2O3S/c1-19-9-15-23(16-10-19)33(31,32)29(17-20-11-13-22(27)14-12-20)18-26(30)28-25-8-4-6-21-5-2-3-7-24(21)25/h2-16H,17-18H2,1H3,(H,28,30) |
| InChIKey | LXOIQYXRZLYYFN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |