C28H25FN2O4S — CID 126068032
2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 126068032) has the molecular formula C28H25FN2O4S and a molecular weight of 504.58 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126068032 |
| Molecular Formula | C28H25FN2O4S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H25FN2O4S/c1-21-7-17-27(18-8-21)36(33,34)31(19-22-9-11-23(29)12-10-22)20-28(32)30-24-13-15-26(16-14-24)35-25-5-3-2-4-6-25/h2-18H,19-20H2,1H3,(H,30,32) |
| InChIKey | YYRLWRFMUDAHNS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |