C25H28FN3O5S2 — CID 1435666
2-[[4-(diethylsulfamoyl)phenyl]sulfonyl-[(4-fluorophenyl)methyl]amino]-N-phenylacetamide (PubChem CID 1435666) has the molecular formula C25H28FN3O5S2 and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[[4-(diethylsulfamoyl)phenyl]sulfonyl-[(4-fluorophenyl)methyl]amino]-N-phenylacetamide.
| Compound Name | 2-[[4-(diethylsulfamoyl)phenyl]sulfonyl-[(4-fluorophenyl)methyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 1435666 |
| Molecular Formula | C25H28FN3O5S2 |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-[[4-(diethylsulfamoyl)phenyl]sulfonyl-[(4-fluorophenyl)methyl]amino]-N-phenylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H28FN3O5S2/c1-3-28(4-2)35(31,32)23-14-16-24(17-15-23)36(33,34)29(18-20-10-12-21(26)13-11-20)19-25(30)27-22-8-6-5-7-9-22/h5-17H,3-4,18-19H2,1-2H3,(H,27,30) |
| InChIKey | CXOAOOMXJYSVNX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |