C22H18Cl3FN2O3S — CID 126068193
2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 126068193) has the molecular formula C22H18Cl3FN2O3S and a molecular weight of 515.82 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 126068193 |
| Molecular Formula | C22H18Cl3FN2O3S |
| Molecular Weight | 515.82 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl3FN2O3S/c1-14-2-8-17(9-3-14)32(30,31)28(12-15-4-6-16(26)7-5-15)13-22(29)27-21-11-19(24)18(23)10-20(21)25/h2-11H,12-13H2,1H3,(H,27,29) |
| InChIKey | ILSKYXHNIYTZRZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|