C20H24FNO4S — CID 100984414
tert-butyl 2-[(4-fluorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetate (PubChem CID 100984414) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl 2-[(4-fluorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetate.
| Compound Name | tert-butyl 2-[(4-fluorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 100984414 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | tert-butyl 2-[(4-fluorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]acetate |
| SMILES | Cc1ccc(CN(CC(=O)OC(C)(C)C)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FNO4S/c1-15-5-7-16(8-6-15)13-22(14-19(23)26-20(2,3)4)27(24,25)18-11-9-17(21)10-12-18/h5-12H,13-14H2,1-4H3 |
| InChIKey | HUZYVYHEGRHXAY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |