C23H21NO6S — CID 123408853
4-[[(4-carboxyphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoic acid (PubChem CID 123408853) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is 4-[[(4-carboxyphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[(4-carboxyphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 123408853 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 4-[[(4-carboxyphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc(CN(Cc2ccc(C(=O)O)cc2)S(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H21NO6S/c1-16-2-4-17(5-3-16)14-24(15-18-6-8-19(9-7-18)22(25)26)31(29,30)21-12-10-20(11-13-21)23(27)28/h2-13H,14-15H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | PKVNWYPGKPFYAS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |