C19H17NO4S2 — CID 1169521
4-[benzyl(thiophen-2-ylmethyl)sulfamoyl]benzoic acid (PubChem CID 1169521) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[benzyl(thiophen-2-ylmethyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[benzyl(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 1169521 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-[benzyl(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H17NO4S2/c21-19(22)16-8-10-18(11-9-16)26(23,24)20(14-17-7-4-12-25-17)13-15-5-2-1-3-6-15/h1-12H,13-14H2,(H,21,22) |
| InChIKey | CNJDOVPOJKWTPS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |