C22H23NO6S2 — CID 1428959
4-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid (PubChem CID 1428959) has the molecular formula C22H23NO6S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 1428959 |
| Molecular Formula | C22H23NO6S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(CCN(Cc2cccs2)S(=O)(=O)c2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C22H23NO6S2/c1-28-20-10-5-16(14-21(20)29-2)11-12-23(15-18-4-3-13-30-18)31(26,27)19-8-6-17(7-9-19)22(24)25/h3-10,13-14H,11-12,15H2,1-2H3,(H,24,25) |
| InChIKey | JFLXFFWRPZGRNQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |