C22H21NO6S — CID 90697398
4-[[benzenesulfonyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]methyl]benzoic acid (PubChem CID 90697398) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-[[benzenesulfonyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[benzenesulfonyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 90697398 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[[benzenesulfonyl-[(4-hydroxy-3-methoxyphenyl)methyl]amino]methyl]benzoic acid |
| SMILES | COc1cc(CN(Cc2ccc(C(=O)O)cc2)S(=O)(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C22H21NO6S/c1-29-21-13-17(9-12-20(21)24)15-23(30(27,28)19-5-3-2-4-6-19)14-16-7-10-18(11-8-16)22(25)26/h2-13,24H,14-15H2,1H3,(H,25,26) |
| InChIKey | XSYITLSSVOYLTM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |