C15H15NO5 — CID 88959300
(4-hydroxy-3-methoxyphenyl)methyl-phenoxycarbamic acid (PubChem CID 88959300) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (4-hydroxy-3-methoxyphenyl)methyl-phenoxycarbamic acid.
| Compound Name | (4-hydroxy-3-methoxyphenyl)methyl-phenoxycarbamic acid |
|---|---|
| PubChem CID | 88959300 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (4-hydroxy-3-methoxyphenyl)methyl-phenoxycarbamic acid |
| SMILES | COc1cc(CN(Oc2ccccc2)C(=O)O)ccc1O |
| InChI | InChI=1S/C15H15NO5/c1-20-14-9-11(7-8-13(14)17)10-16(15(18)19)21-12-5-3-2-4-6-12/h2-9,17H,10H2,1H3,(H,18,19) |
| InChIKey | JMJDAOFPVFIWEO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|