About ethyl(phenoxy)carbamic acid
ethyl(phenoxy)carbamic acid (PubChem CID 87330615) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is ethyl(phenoxy)carbamic acid.
Molecular Properties
| Compound Name | ethyl(phenoxy)carbamic acid |
| PubChem CID | 87330615 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | ethyl(phenoxy)carbamic acid |
| SMILES | CCN(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c1-2-10(9(11)12)13-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,12) |
| InChIKey | DVTWGPZITVEGPD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl(phenoxy)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(phenoxy)carbamic acid?
The IUPAC name of ethyl(phenoxy)carbamic acid (CID 87330615) is ethyl(phenoxy)carbamic acid.
What is the SMILES notation for ethyl(phenoxy)carbamic acid?
The canonical SMILES for ethyl(phenoxy)carbamic acid is CCN(Oc1ccccc1)C(=O)O.
What is the InChIKey of ethyl(phenoxy)carbamic acid?
The InChIKey is DVTWGPZITVEGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-2-10(9(11)12)13-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,12).
What are the key properties of ethyl(phenoxy)carbamic acid?
ethyl(phenoxy)carbamic acid has a molecular weight of 181.19 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(phenoxy)carbamic acid is sourced from PubChem (CID 87330615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).