About N,N-diphenoxyethanamine
N,N-diphenoxyethanamine (PubChem CID 88599470) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is N,N-diphenoxyethanamine.
Molecular Properties
| Compound Name | N,N-diphenoxyethanamine |
| PubChem CID | 88599470 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N,N-diphenoxyethanamine |
| SMILES | CCN(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-2-15(16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | UMJPHISYIPZDIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diphenoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenoxyethanamine?
The IUPAC name of N,N-diphenoxyethanamine (CID 88599470) is N,N-diphenoxyethanamine.
What is the SMILES notation for N,N-diphenoxyethanamine?
The canonical SMILES for N,N-diphenoxyethanamine is CCN(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of N,N-diphenoxyethanamine?
The InChIKey is UMJPHISYIPZDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-2-15(16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h3-12H,2H2,1H3.
What are the key properties of N,N-diphenoxyethanamine?
N,N-diphenoxyethanamine has a molecular weight of 229.28 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenoxyethanamine is sourced from PubChem (CID 88599470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).