C12H22BNO3 — CID 157075619
N,N-diethylethanamine;phenoxyboronic acid (PubChem CID 157075619) has the molecular formula C12H22BNO3 and a molecular weight of 239.12 g/mol. Its IUPAC name is N,N-diethylethanamine;phenoxyboronic acid.
| Compound Name | N,N-diethylethanamine;phenoxyboronic acid |
|---|---|
| PubChem CID | 157075619 |
| Molecular Formula | C12H22BNO3 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,N-diethylethanamine;phenoxyboronic acid |
| SMILES | CCN(CC)CC.OB(O)Oc1ccccc1 |
| InChI | InChI=1S/C6H7BO3.C6H15N/c8-7(9)10-6-4-2-1-3-5-6;1-4-7(5-2)6-3/h1-5,8-9H;4-6H2,1-3H3 |
| InChIKey | ACYCTVQLPREASU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|