C18H33BFNO3 — CID 172735609
N,N-dibutylbutan-1-amine;(4-fluorophenoxy)boronic acid (PubChem CID 172735609) has the molecular formula C18H33BFNO3 and a molecular weight of 341.28 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;(4-fluorophenoxy)boronic acid.
| Compound Name | N,N-dibutylbutan-1-amine;(4-fluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 172735609 |
| Molecular Formula | C18H33BFNO3 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | N,N-dibutylbutan-1-amine;(4-fluorophenoxy)boronic acid |
| SMILES | CCCCN(CCCC)CCCC.OB(O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C12H27N.C6H6BFO3/c1-4-7-10-13(11-8-5-2)12-9-6-3;8-5-1-3-6(4-2-5)11-7(9)10/h4-12H2,1-3H3;1-4,9-10H |
| InChIKey | IJUDBVLPBWVUPO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|