About dodecane-1,2-diol;(4-fluorophenoxy)boronic acid
dodecane-1,2-diol;(4-fluorophenoxy)boronic acid (PubChem CID 175055882) has the molecular formula C18H32BFO5
and a molecular weight of 358.26 g/mol. Its IUPAC name is dodecane-1,2-diol;(4-fluorophenoxy)boronic acid.
Molecular Properties
| Compound Name | dodecane-1,2-diol;(4-fluorophenoxy)boronic acid |
| PubChem CID | 175055882 |
| Molecular Formula | C18H32BFO5 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | dodecane-1,2-diol;(4-fluorophenoxy)boronic acid |
| SMILES | CCCCCCCCCCC(O)CO.OB(O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C12H26O2.C6H6BFO3/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;8-5-1-3-6(4-2-5)11-7(9)10/h12-14H,2-11H2,1H3;1-4,9-10H |
| InChIKey | VNGPWWBNRSDSRL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dodecane-1,2-diol;(4-fluorophenoxy)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecane-1,2-diol;(4-fluorophenoxy)boronic acid?
The IUPAC name of dodecane-1,2-diol;(4-fluorophenoxy)boronic acid (CID 175055882) is dodecane-1,2-diol;(4-fluorophenoxy)boronic acid.
What is the SMILES notation for dodecane-1,2-diol;(4-fluorophenoxy)boronic acid?
The canonical SMILES for dodecane-1,2-diol;(4-fluorophenoxy)boronic acid is CCCCCCCCCCC(O)CO.OB(O)Oc1ccc(F)cc1.
What is the InChIKey of dodecane-1,2-diol;(4-fluorophenoxy)boronic acid?
The InChIKey is VNGPWWBNRSDSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2.C6H6BFO3/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;8-5-1-3-6(4-2-5)11-7(9)10/h12-14H,2-11H2,1H3;1-4,9-10H.
What are the key properties of dodecane-1,2-diol;(4-fluorophenoxy)boronic acid?
dodecane-1,2-diol;(4-fluorophenoxy)boronic acid has a molecular weight of 358.26 g/mol, XLogP of 3.04, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dodecane-1,2-diol;(4-fluorophenoxy)boronic acid is sourced from PubChem (CID 175055882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).