About octane-1,2-diol
octane-1,2-diol (PubChem CID 159791136) has the molecular formula C16H36O4
and a molecular weight of 292.46 g/mol. Its IUPAC name is octane-1,2-diol.
Molecular Properties
| Compound Name | octane-1,2-diol |
| PubChem CID | 159791136 |
| Molecular Formula | C16H36O4 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | octane-1,2-diol |
| SMILES | CCCCCCC(O)CO.CCCCCCC(O)CO |
| InChI | InChI=1S/2C8H18O2/c2*1-2-3-4-5-6-8(10)7-9/h2*8-10H,2-7H2,1H3 |
| InChIKey | NIOOCPXLCDRVAO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-1,2-diol?
The IUPAC name of octane-1,2-diol (CID 159791136) is octane-1,2-diol.
What is the SMILES notation for octane-1,2-diol?
The canonical SMILES for octane-1,2-diol is CCCCCCC(O)CO.CCCCCCC(O)CO.
What is the InChIKey of octane-1,2-diol?
The InChIKey is NIOOCPXLCDRVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H18O2/c2*1-2-3-4-5-6-8(10)7-9/h2*8-10H,2-7H2,1H3.
What are the key properties of octane-1,2-diol?
octane-1,2-diol has a molecular weight of 292.46 g/mol, XLogP of 2.62, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octane-1,2-diol is sourced from PubChem (CID 159791136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).