About (2R)-decane-1,2-diol
(2R)-decane-1,2-diol (PubChem CID 10888425) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is (2R)-decane-1,2-diol.
Molecular Properties
| Compound Name | (2R)-decane-1,2-diol |
| PubChem CID | 10888425 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (2R)-decane-1,2-diol |
| SMILES | CCCCCCCC[C@@H](O)CO |
| InChI | InChI=1S/C10H22O2/c1-2-3-4-5-6-7-8-10(12)9-11/h10-12H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | YSRSBDQINUMTIF-SNVBAGLBSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-decane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-decane-1,2-diol?
The IUPAC name of (2R)-decane-1,2-diol (CID 10888425) is (2R)-decane-1,2-diol.
What is the SMILES notation for (2R)-decane-1,2-diol?
The canonical SMILES for (2R)-decane-1,2-diol is CCCCCCCC[C@@H](O)CO.
What is the InChIKey of (2R)-decane-1,2-diol?
The InChIKey is YSRSBDQINUMTIF-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H22O2/c1-2-3-4-5-6-7-8-10(12)9-11/h10-12H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of (2R)-decane-1,2-diol?
(2R)-decane-1,2-diol has a molecular weight of 174.28 g/mol, XLogP of 2.09, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-decane-1,2-diol is sourced from PubChem (CID 10888425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).