C9H20O5 — CID 87196944
carbonic acid;octane-1,2-diol (PubChem CID 87196944) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is carbonic acid;octane-1,2-diol.
| Compound Name | carbonic acid;octane-1,2-diol |
|---|---|
| PubChem CID | 87196944 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | carbonic acid;octane-1,2-diol |
| SMILES | CCCCCCC(O)CO.O=C(O)O |
| InChI | InChI=1S/C8H18O2.CH2O3/c1-2-3-4-5-6-8(10)7-9;2-1(3)4/h8-10H,2-7H2,1H3;(H2,2,3,4) |
| InChIKey | RHKKDUHTHUSBTQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|