C15H28O14 — CID 162195278
bis(2,3-dihydroxybutanedioic acid);heptane-1,2-diol (PubChem CID 162195278) has the molecular formula C15H28O14 and a molecular weight of 432.38 g/mol. Its IUPAC name is bis(2,3-dihydroxybutanedioic acid);heptane-1,2-diol.
| Compound Name | bis(2,3-dihydroxybutanedioic acid);heptane-1,2-diol |
|---|---|
| PubChem CID | 162195278 |
| Molecular Formula | C15H28O14 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | bis(2,3-dihydroxybutanedioic acid);heptane-1,2-diol |
| SMILES | CCCCCC(O)CO.O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C7H16O2.2C4H6O6/c1-2-3-4-5-7(9)6-8;2*5-1(3(7)8)2(6)4(9)10/h7-9H,2-6H2,1H3;2*1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | ZQVWSCKEQIQMQF-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 270.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|