About sodium;dodecane-1,2-diol;acetate
sodium;dodecane-1,2-diol;acetate (PubChem CID 87531967) has the molecular formula C14H29NaO4
and a molecular weight of 284.37 g/mol. Its IUPAC name is sodium;dodecane-1,2-diol;acetate.
Molecular Properties
| Compound Name | sodium;dodecane-1,2-diol;acetate |
| PubChem CID | 87531967 |
| Molecular Formula | C14H29NaO4 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | sodium;dodecane-1,2-diol;acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCCC(O)CO.[Na+] |
| InChI | InChI=1S/C12H26O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;1-2(3)4;/h12-14H,2-11H2,1H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | IZYCZYCJLXEFOG-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecane-1,2-diol;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecane-1,2-diol;acetate?
The IUPAC name of sodium;dodecane-1,2-diol;acetate (CID 87531967) is sodium;dodecane-1,2-diol;acetate.
What is the SMILES notation for sodium;dodecane-1,2-diol;acetate?
The canonical SMILES for sodium;dodecane-1,2-diol;acetate is CC(=O)[O-].CCCCCCCCCCC(O)CO.[Na+].
What is the InChIKey of sodium;dodecane-1,2-diol;acetate?
The InChIKey is IZYCZYCJLXEFOG-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;1-2(3)4;/h12-14H,2-11H2,1H3;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;dodecane-1,2-diol;acetate?
sodium;dodecane-1,2-diol;acetate has a molecular weight of 284.37 g/mol, XLogP of -1.37, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecane-1,2-diol;acetate is sourced from PubChem (CID 87531967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).