About sodium;decane-1,2-diol;acetate
sodium;decane-1,2-diol;acetate (PubChem CID 162338833) has the molecular formula C12H25NaO4
and a molecular weight of 256.32 g/mol. Its IUPAC name is sodium;decane-1,2-diol;acetate.
Molecular Properties
| Compound Name | sodium;decane-1,2-diol;acetate |
| PubChem CID | 162338833 |
| Molecular Formula | C12H25NaO4 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | sodium;decane-1,2-diol;acetate |
| SMILES | CC(=O)[O-].CCCCCCCCC(O)CO.[Na+] |
| InChI | InChI=1S/C10H22O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-10(12)9-11;1-2(3)4;/h10-12H,2-9H2,1H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | HWWILGIEYJICSX-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;decane-1,2-diol;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;decane-1,2-diol;acetate?
The IUPAC name of sodium;decane-1,2-diol;acetate (CID 162338833) is sodium;decane-1,2-diol;acetate.
What is the SMILES notation for sodium;decane-1,2-diol;acetate?
The canonical SMILES for sodium;decane-1,2-diol;acetate is CC(=O)[O-].CCCCCCCCC(O)CO.[Na+].
What is the InChIKey of sodium;decane-1,2-diol;acetate?
The InChIKey is HWWILGIEYJICSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22O2.C2H4O2.Na/c1-2-3-4-5-6-7-8-10(12)9-11;1-2(3)4;/h10-12H,2-9H2,1H3;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;decane-1,2-diol;acetate?
sodium;decane-1,2-diol;acetate has a molecular weight of 256.32 g/mol, XLogP of -2.15, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;decane-1,2-diol;acetate is sourced from PubChem (CID 162338833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).