C19H42O4 — CID 174889231
decane-1,10-diol;nonane-1,2-diol (PubChem CID 174889231) has the molecular formula C19H42O4 and a molecular weight of 334.54 g/mol. Its IUPAC name is decane-1,10-diol;nonane-1,2-diol.
| Compound Name | decane-1,10-diol;nonane-1,2-diol |
|---|---|
| PubChem CID | 174889231 |
| Molecular Formula | C19H42O4 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | decane-1,10-diol;nonane-1,2-diol |
| SMILES | CCCCCCCC(O)CO.OCCCCCCCCCCO |
| InChI | InChI=1S/C10H22O2.C9H20O2/c11-9-7-5-3-1-2-4-6-8-10-12;1-2-3-4-5-6-7-9(11)8-10/h11-12H,1-10H2;9-11H,2-8H2,1H3 |
| InChIKey | DRXDXXIPQKORDK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|