About tridecane-1,5-diol
tridecane-1,5-diol (PubChem CID 15587437) has the molecular formula C13H28O2
and a molecular weight of 216.36 g/mol. Its IUPAC name is tridecane-1,5-diol.
Molecular Properties
| Compound Name | tridecane-1,5-diol |
| PubChem CID | 15587437 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | tridecane-1,5-diol |
| SMILES | CCCCCCCCC(O)CCCCO |
| InChI | InChI=1S/C13H28O2/c1-2-3-4-5-6-7-10-13(15)11-8-9-12-14/h13-15H,2-12H2,1H3 |
| InChIKey | GRGZJTVMTDNWPN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecane-1,5-diol?
The IUPAC name of tridecane-1,5-diol (CID 15587437) is tridecane-1,5-diol.
What is the SMILES notation for tridecane-1,5-diol?
The canonical SMILES for tridecane-1,5-diol is CCCCCCCCC(O)CCCCO.
What is the InChIKey of tridecane-1,5-diol?
The InChIKey is GRGZJTVMTDNWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2/c1-2-3-4-5-6-7-10-13(15)11-8-9-12-14/h13-15H,2-12H2,1H3.
What are the key properties of tridecane-1,5-diol?
tridecane-1,5-diol has a molecular weight of 216.36 g/mol, XLogP of 3.26, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridecane-1,5-diol is sourced from PubChem (CID 15587437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).